1, different sources

Fructose comes from fruit pulp and honey, and glucose is the most widely distributed and important monosaccharide in nature, which can come from photosynthesis of plants.

2. They have different structures and are "isomers" of each other.

Glucose is aldose, and its structure is

CH2OH

(CHOH)4CHO .

Fructose is a ketose with the structure of CH2OH(CHOH)3-(C=O)-CH2OH.

3, the sweetness is different

Fructose is the sweetest sugar. The lower the temperature, the stronger the sweetness. Glucose is weak in sweetness, but refreshing in taste. Compared with sugar, fructose and glucose have the characteristics of no residual sweetness in the mouth, so the taste is better; It is also suitable for low-temperature utilization, so it is suitable for making cool drinks, cold drinks, milk drinks and so on. And the price is cheap, so high fructose corn syrup is popularized by wisdom.

4. Different metabolism

Glucose is absorbed by the small intestine and enters the blood, and the blood sugar level rises. The pancreas secretes insulin to lower the blood sugar level, and the insulin is transported to cells all over the body, and the excess is converted into fat.

Fructose is mostly metabolized in the liver, without the participation of insulin, and it will not raise blood sugar. Because the rapid increase of blood sugar level is related to obesity and saccharification.

5. Different functions

After ingesting glucose, insulin secretion increases and blood sugar level rises, so the brain will receive a special satiety signal, thus suppressing appetite.

Fructose does not stimulate insulin secretion, nor does it directly raise blood sugar level. The brain does not receive the signal of satiety, nor does it suppress appetite. This leads to a series of consequences such as excessive intake, fat accumulation and obesity.